About Dibromtoluchinon
Dibromtoluchinon (PubChem CID 129647461) has the molecular formula C7H4Br2O2
and a molecular weight of 279.91 g/mol. Its IUPAC name is 3,4-dibromo-6-methylcyclohexa-3,5-diene-1,2-dione.
Molecular Properties
| Compound Name | Dibromtoluchinon |
| PubChem CID | 129647461 |
| Molecular Formula | C7H4Br2O2 |
| Molecular Weight | 279.91 g/mol |
| Exact Mass | 279.86 |
| IUPAC Name | 3,4-dibromo-6-methylcyclohexa-3,5-diene-1,2-dione |
| SMILES | CC1=CC(=C(C(=O)C1=O)Br)Br |
| InChI | InChI=1S/C7H4Br2O2/c1-3-2-4(8)5(9)7(11)6(3)10/h2H,1H3 |
| InChIKey | RRCCSENCQIZLPC-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 34.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | 300 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.91 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze Dibromtoluchinon with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Dibromtoluchinon?
The IUPAC name of Dibromtoluchinon (CID 129647461) is 3,4-dibromo-6-methylcyclohexa-3,5-diene-1,2-dione.
What is the SMILES notation for Dibromtoluchinon?
The canonical SMILES for Dibromtoluchinon is CC1=CC(=C(C(=O)C1=O)Br)Br.
What is the InChIKey of Dibromtoluchinon?
The InChIKey is RRCCSENCQIZLPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4Br2O2/c1-3-2-4(8)5(9)7(11)6(3)10/h2H,1H3.
What are the key properties of Dibromtoluchinon?
Dibromtoluchinon has a molecular weight of 279.91 g/mol, XLogP of 2.00, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Dibromtoluchinon is sourced from PubChem (CID 129647461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).