C11H7BrO2 — CID 15482878
(3aE,5Z,9E)-1-bromo-7H-cyclopenta[8]annulene-3,8-dione (PubChem CID 15482878) has the molecular formula C11H7BrO2 and a molecular weight of 251.08 g/mol. Its IUPAC name is (3aE,5Z,9E)-1-bromo-7H-cyclopenta[8]annulene-3,8-dione.
| Compound Name | (3aE,5Z,9E)-1-bromo-7H-cyclopenta[8]annulene-3,8-dione |
|---|---|
| PubChem CID | 15482878 |
| Molecular Formula | C11H7BrO2 |
| Molecular Weight | 251.08 g/mol |
| Exact Mass | 249.96 |
| IUPAC Name | (3aE,5Z,9E)-1-bromo-7H-cyclopenta[8]annulene-3,8-dione |
| SMILES | O=C1/C=C2/C(Br)=CC(=O)/C2=C/C=C\C1 |
| InChI | InChI=1S/C11H7BrO2/c12-10-6-11(14)8-4-2-1-3-7(13)5-9(8)10/h1-2,4-6H,3H2/b2-1-,8-4+,9-5+ |
| InChIKey | HAPQWRGMJKUNDC-RSZQDEMGSA-N |
| XLogP | 2.23 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.08 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |