C24H14O2 — CID 11588034
2-phenyl-3-(2-phenylethynyl)naphthalene-1,4-dione (PubChem CID 11588034) has the molecular formula C24H14O2 and a molecular weight of 334.37 g/mol. Its IUPAC name is 2-phenyl-3-(2-phenylethynyl)naphthalene-1,4-dione.
| Compound Name | 2-phenyl-3-(2-phenylethynyl)naphthalene-1,4-dione |
|---|---|
| PubChem CID | 11588034 |
| Molecular Formula | C24H14O2 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 2-phenyl-3-(2-phenylethynyl)naphthalene-1,4-dione |
| SMILES | O=C1C(C#Cc2ccccc2)=C(c2ccccc2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C24H14O2/c25-23-19-13-7-8-14-20(19)24(26)22(18-11-5-2-6-12-18)21(23)16-15-17-9-3-1-4-10-17/h1-14H |
| InChIKey | HHGMXIVMPZBSET-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|