About 2,5-ditert-butylnaphthalene-1,4-dione
2,5-ditert-butylnaphthalene-1,4-dione (PubChem CID 141075231) has the molecular formula C18H22O2
and a molecular weight of 270.37 g/mol. Its IUPAC name is 2,5-ditert-butylnaphthalene-1,4-dione.
Molecular Properties
| Compound Name | 2,5-ditert-butylnaphthalene-1,4-dione |
| PubChem CID | 141075231 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 2,5-ditert-butylnaphthalene-1,4-dione |
| SMILES | CC(C)(C)C1=CC(=O)c2c(cccc2C(C)(C)C)C1=O |
| InChI | InChI=1S/C18H22O2/c1-17(2,3)12-9-7-8-11-15(12)14(19)10-13(16(11)20)18(4,5)6/h7-10H,1-6H3 |
| InChIKey | LUKDHLGMMSAZMH-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 2,5-ditert-butylnaphthalene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-ditert-butylnaphthalene-1,4-dione?
The IUPAC name of 2,5-ditert-butylnaphthalene-1,4-dione (CID 141075231) is 2,5-ditert-butylnaphthalene-1,4-dione.
What is the SMILES notation for 2,5-ditert-butylnaphthalene-1,4-dione?
The canonical SMILES for 2,5-ditert-butylnaphthalene-1,4-dione is CC(C)(C)C1=CC(=O)c2c(cccc2C(C)(C)C)C1=O.
What is the InChIKey of 2,5-ditert-butylnaphthalene-1,4-dione?
The InChIKey is LUKDHLGMMSAZMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22O2/c1-17(2,3)12-9-7-8-11-15(12)14(19)10-13(16(11)20)18(4,5)6/h7-10H,1-6H3.
What are the key properties of 2,5-ditert-butylnaphthalene-1,4-dione?
2,5-ditert-butylnaphthalene-1,4-dione has a molecular weight of 270.37 g/mol, XLogP of 4.34, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-ditert-butylnaphthalene-1,4-dione is sourced from PubChem (CID 141075231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).