C20H10O7 — CID 632371
4,5-dihydroxy-3-(8-hydroxy-1,4-dioxonaphthalen-2-yl)naphthalene-1,2-dione (PubChem CID 632371) has the molecular formula C20H10O7 and a molecular weight of 362.29 g/mol. Its IUPAC name is 4,5-dihydroxy-3-(8-hydroxy-1,4-dioxonaphthalen-2-yl)naphthalene-1,2-dione.
| Compound Name | 4,5-dihydroxy-3-(8-hydroxy-1,4-dioxonaphthalen-2-yl)naphthalene-1,2-dione |
|---|---|
| PubChem CID | 632371 |
| Molecular Formula | C20H10O7 |
| Molecular Weight | 362.29 g/mol |
| Exact Mass | 362.04 |
| IUPAC Name | 4,5-dihydroxy-3-(8-hydroxy-1,4-dioxonaphthalen-2-yl)naphthalene-1,2-dione |
| SMILES | O=C1C(=O)c2cccc(O)c2C(O)=C1C1=CC(=O)c2cccc(O)c2C1=O |
| InChI | InChI=1S/C20H10O7/c21-11-5-1-3-8-13(23)7-10(17(24)14(8)11)16-19(26)15-9(18(25)20(16)27)4-2-6-12(15)22/h1-7,21-22,26H |
| InChIKey | FHTFLOTXXNWRGB-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.29 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|