C16H9Cl2NO2 — CID 142635559
5-amino-2-(3,5-dichlorophenyl)naphthalene-1,4-dione (PubChem CID 142635559) has the molecular formula C16H9Cl2NO2 and a molecular weight of 318.16 g/mol. Its IUPAC name is 5-amino-2-(3,5-dichlorophenyl)naphthalene-1,4-dione.
| Compound Name | 5-amino-2-(3,5-dichlorophenyl)naphthalene-1,4-dione |
|---|---|
| PubChem CID | 142635559 |
| Molecular Formula | C16H9Cl2NO2 |
| Molecular Weight | 318.16 g/mol |
| Exact Mass | 317.00 |
| IUPAC Name | 5-amino-2-(3,5-dichlorophenyl)naphthalene-1,4-dione |
| SMILES | Nc1cccc2c1C(=O)C=C(c1cc(Cl)cc(Cl)c1)C2=O |
| InChI | InChI=1S/C16H9Cl2NO2/c17-9-4-8(5-10(18)6-9)12-7-14(20)15-11(16(12)21)2-1-3-13(15)19/h1-7H,19H2 |
| InChIKey | HAIUTSHBWJWLHB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.16 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|