C16H8F2O2 — CID 135012778
2-(3,5-difluorophenyl)naphthalene-1,4-dione (PubChem CID 135012778) has the molecular formula C16H8F2O2 and a molecular weight of 270.23 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)naphthalene-1,4-dione.
| Compound Name | 2-(3,5-difluorophenyl)naphthalene-1,4-dione |
|---|---|
| PubChem CID | 135012778 |
| Molecular Formula | C16H8F2O2 |
| Molecular Weight | 270.23 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | 2-(3,5-difluorophenyl)naphthalene-1,4-dione |
| SMILES | O=C1C=C(c2cc(F)cc(F)c2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C16H8F2O2/c17-10-5-9(6-11(18)7-10)14-8-15(19)12-3-1-2-4-13(12)16(14)20/h1-8H |
| InChIKey | XGUNXNPPXQLAOB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.23 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|