C23H16O4 — CID 100971114
6-benzyl-5-methoxy-9,10-dioxoanthracene-2-carbaldehyde (PubChem CID 100971114) has the molecular formula C23H16O4 and a molecular weight of 356.38 g/mol. Its IUPAC name is 6-benzyl-5-methoxy-9,10-dioxoanthracene-2-carbaldehyde.
| Compound Name | 6-benzyl-5-methoxy-9,10-dioxoanthracene-2-carbaldehyde |
|---|---|
| PubChem CID | 100971114 |
| Molecular Formula | C23H16O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 6-benzyl-5-methoxy-9,10-dioxoanthracene-2-carbaldehyde |
| SMILES | COc1c(Cc2ccccc2)ccc2c1C(=O)c1ccc(C=O)cc1C2=O |
| InChI | InChI=1S/C23H16O4/c1-27-23-16(11-14-5-3-2-4-6-14)8-10-18-20(23)22(26)17-9-7-15(13-24)12-19(17)21(18)25/h2-10,12-13H,11H2,1H3 |
| InChIKey | WRGNSBFVFOPVQC-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|