2-[(4-methoxy-2,3-dimethylphenyl)methyl]propanedioic acid

C13H16O5 — CID 170895399

IUPAC2-[(4-methoxy-2,3-dimethylphenyl)methyl]propanedioic acid
SMILESCOc1ccc(CC(C(=O)O)C(=O)O)c(C)c1C
InChIInChI=1S/C13H16O5/c1-7-8(2)11(18-3)5-4-9(7)6-10(12(14)15)13(16)17/h4-5,10H,6H2,1-3H3,(H,14,15)(H,16,17)
InChIKeyOPDGEKDQNLKFIF-UHFFFAOYSA-N
MW252.27 g/mol
LogP1.64
Rot. Bonds5

About 2-[(4-methoxy-2,3-dimethylphenyl)methyl]propanedioic acid

2-[(4-methoxy-2,3-dimethylphenyl)methyl]propanedioic acid (PubChem CID 170895399) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is 2-[(4-methoxy-2,3-dimethylphenyl)methyl]propanedioic acid.

Molecular Properties

Compound Name2-[(4-methoxy-2,3-dimethylphenyl)methyl]propanedioic acid
PubChem CID170895399
Molecular FormulaC13H16O5
Molecular Weight252.27 g/mol
Exact Mass252.10
IUPAC Name2-[(4-methoxy-2,3-dimethylphenyl)methyl]propanedioic acid
SMILESCOc1ccc(CC(C(=O)O)C(=O)O)c(C)c1C
InChIInChI=1S/C13H16O5/c1-7-8(2)11(18-3)5-4-9(7)6-10(12(14)15)13(16)17/h4-5,10H,6H2,1-3H3,(H,14,15)(H,16,17)
InChIKeyOPDGEKDQNLKFIF-UHFFFAOYSA-N
XLogP1.64
TPSA83.83 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500252.27
LogP ≤ 51.64
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 2-[(4-methoxy-2,3-dimethylphenyl)methyl]propanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(4-methoxy-2,3-dimethylphenyl)methyl]propanedioic acid?
The IUPAC name of 2-[(4-methoxy-2,3-dimethylphenyl)methyl]propanedioic acid (CID 170895399) is 2-[(4-methoxy-2,3-dimethylphenyl)methyl]propanedioic acid.
What is the SMILES notation for 2-[(4-methoxy-2,3-dimethylphenyl)methyl]propanedioic acid?
The canonical SMILES for 2-[(4-methoxy-2,3-dimethylphenyl)methyl]propanedioic acid is COc1ccc(CC(C(=O)O)C(=O)O)c(C)c1C.
What is the InChIKey of 2-[(4-methoxy-2,3-dimethylphenyl)methyl]propanedioic acid?
The InChIKey is OPDGEKDQNLKFIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O5/c1-7-8(2)11(18-3)5-4-9(7)6-10(12(14)15)13(16)17/h4-5,10H,6H2,1-3H3,(H,14,15)(H,16,17).
What are the key properties of 2-[(4-methoxy-2,3-dimethylphenyl)methyl]propanedioic acid?
2-[(4-methoxy-2,3-dimethylphenyl)methyl]propanedioic acid has a molecular weight of 252.27 g/mol, XLogP of 1.64, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-methoxy-2,3-dimethylphenyl)methyl]propanedioic acid is sourced from PubChem (CID 170895399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).