C28H28O3P+ — CID 140705355
benzyl-diphenyl-(2,3,4-trimethoxyphenyl)phosphanium (PubChem CID 140705355) has the molecular formula C28H28O3P+ and a molecular weight of 443.50 g/mol. Its IUPAC name is benzyl-diphenyl-(2,3,4-trimethoxyphenyl)phosphanium.
| Compound Name | benzyl-diphenyl-(2,3,4-trimethoxyphenyl)phosphanium |
|---|---|
| PubChem CID | 140705355 |
| Molecular Formula | C28H28O3P+ |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | benzyl-diphenyl-(2,3,4-trimethoxyphenyl)phosphanium |
| SMILES | COc1ccc([P+](Cc2ccccc2)(c2ccccc2)c2ccccc2)c(OC)c1OC |
| InChI | InChI=1S/C28H28O3P/c1-29-25-19-20-26(28(31-3)27(25)30-2)32(23-15-9-5-10-16-23,24-17-11-6-12-18-24)21-22-13-7-4-8-14-22/h4-20H,21H2,1-3H3/q+1 |
| InChIKey | GJQYRWIOPDGJTK-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|