C26H24F6OP2 — CID 174642384
benzyl-(2-methoxyphenyl)-diphenylphosphanium hexafluorophosphate (PubChem CID 174642384) has the molecular formula C26H24F6OP2 and a molecular weight of 528.41 g/mol. Its IUPAC name is benzyl-(2-methoxyphenyl)-diphenylphosphanium hexafluorophosphate.
| Compound Name | benzyl-(2-methoxyphenyl)-diphenylphosphanium hexafluorophosphate |
|---|---|
| PubChem CID | 174642384 |
| Molecular Formula | C26H24F6OP2 |
| Molecular Weight | 528.41 g/mol |
| Exact Mass | 528.12 |
| IUPAC Name | benzyl-(2-methoxyphenyl)-diphenylphosphanium hexafluorophosphate |
| SMILES | COc1ccccc1[P+](Cc1ccccc1)(c1ccccc1)c1ccccc1.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C26H24OP.F6P/c1-27-25-19-11-12-20-26(25)28(23-15-7-3-8-16-23,24-17-9-4-10-18-24)21-22-13-5-2-6-14-22;1-7(2,3,4,5)6/h2-20H,21H2,1H3;/q+1;-1 |
| InChIKey | WEVANGCIZVCGII-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.41 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|