C54H56Br2O6P2+2 — CID 102205183
2-[2-[2-[2,5-dibromo-4-[2-[2-(2-triphenylphosphaniumylethoxy)ethoxy]ethoxy]phenoxy]ethoxy]ethoxy]ethyl-triphenylphosphanium (PubChem CID 102205183) has the molecular formula C54H56Br2O6P2+2 and a molecular weight of 1022.79 g/mol. Its IUPAC name is 2-[2-[2-[2,5-dibromo-4-[2-[2-(2-triphenylphosphaniumylethoxy)ethoxy]ethoxy]phenoxy]ethoxy]ethoxy]ethyl-triphenylphosphanium.
| Compound Name | 2-[2-[2-[2,5-dibromo-4-[2-[2-(2-triphenylphosphaniumylethoxy)ethoxy]ethoxy]phenoxy]ethoxy]ethoxy]ethyl-triphenylphosphanium |
|---|---|
| PubChem CID | 102205183 |
| Molecular Formula | C54H56Br2O6P2+2 |
| Molecular Weight | 1022.79 g/mol |
| Exact Mass | 1020.19 |
| IUPAC Name | 2-[2-[2-[2,5-dibromo-4-[2-[2-(2-triphenylphosphaniumylethoxy)ethoxy]ethoxy]phenoxy]ethoxy]ethoxy]ethyl-triphenylphosphanium |
| SMILES | Brc1cc(OCCOCCOCC[P+](c2ccccc2)(c2ccccc2)c2ccccc2)c(Br)cc1OCCOCCOCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C54H56Br2O6P2/c55-51-44-54(62-38-36-58-32-34-60-40-42-64(48-25-13-4-14-26-48,49-27-15-5-16-28-49)50-29-17-6-18-30-50)52(56)43-53(51)61-37-35-57-31-33-59-39-41-63(45-19-7-1-8-20-45,46-21-9-2-10-22-46)47-23-11-3-12-24-47/h1-30,43-44H,31-42H2/q+2 |
| InChIKey | SCSSNKWGRFZDKB-UHFFFAOYSA-N |
| XLogP | 10.02 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1022.79 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|