C28H27Cl2O3PRu — CID 139241375
dichloro-[(2,4,5-trimethoxyphenyl)methylidene]ruthenium;triphenylphosphane (PubChem CID 139241375) has the molecular formula C28H27Cl2O3PRu and a molecular weight of 614.47 g/mol. Its IUPAC name is dichloro-[(2,4,5-trimethoxyphenyl)methylidene]ruthenium;triphenylphosphane.
| Compound Name | dichloro-[(2,4,5-trimethoxyphenyl)methylidene]ruthenium;triphenylphosphane |
|---|---|
| PubChem CID | 139241375 |
| Molecular Formula | C28H27Cl2O3PRu |
| Molecular Weight | 614.47 g/mol |
| Exact Mass | 614.01 |
| IUPAC Name | dichloro-[(2,4,5-trimethoxyphenyl)methylidene]ruthenium;triphenylphosphane |
| SMILES | COc1cc(OC)c(OC)cc1C=[Ru](Cl)Cl.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C10H12O3.2ClH.Ru/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-7-5-9(12-3)10(13-4)6-8(7)11-2;;;/h1-15H;1,5-6H,2-4H3;2*1H;/q;;;;+2/p-2 |
| InChIKey | SBDVDVSNBSLUMP-UHFFFAOYSA-L |
| XLogP | 6.23 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.47 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|