C16H23ClO — CID 83938156
4-chloro-2-[(Z)-hept-5-en-3-yl]-1-methoxy-3,5-dimethylbenzene (PubChem CID 83938156) has the molecular formula C16H23ClO and a molecular weight of 266.81 g/mol. Its IUPAC name is 4-chloro-2-[(Z)-hept-5-en-3-yl]-1-methoxy-3,5-dimethylbenzene.
| Compound Name | 4-chloro-2-[(Z)-hept-5-en-3-yl]-1-methoxy-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 83938156 |
| Molecular Formula | C16H23ClO |
| Molecular Weight | 266.81 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 4-chloro-2-[(Z)-hept-5-en-3-yl]-1-methoxy-3,5-dimethylbenzene |
| SMILES | C/C=C\CC(CC)c1c(OC)cc(C)c(Cl)c1C |
| InChI | InChI=1S/C16H23ClO/c1-6-8-9-13(7-2)15-12(4)16(17)11(3)10-14(15)18-5/h6,8,10,13H,7,9H2,1-5H3/b8-6- |
| InChIKey | LGOFCZZHQNWRIL-VURMDHGXSA-N |
| XLogP | 5.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.81 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|