C14H18Cl2O — CID 83928669
1,3-dichloro-5-[(Z)-hept-5-en-3-yl]-2-methoxybenzene (PubChem CID 83928669) has the molecular formula C14H18Cl2O and a molecular weight of 273.20 g/mol. Its IUPAC name is 1,3-dichloro-5-[(Z)-hept-5-en-3-yl]-2-methoxybenzene.
| Compound Name | 1,3-dichloro-5-[(Z)-hept-5-en-3-yl]-2-methoxybenzene |
|---|---|
| PubChem CID | 83928669 |
| Molecular Formula | C14H18Cl2O |
| Molecular Weight | 273.20 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 1,3-dichloro-5-[(Z)-hept-5-en-3-yl]-2-methoxybenzene |
| SMILES | C/C=C\CC(CC)c1cc(Cl)c(OC)c(Cl)c1 |
| InChI | InChI=1S/C14H18Cl2O/c1-4-6-7-10(5-2)11-8-12(15)14(17-3)13(16)9-11/h4,6,8-10H,5,7H2,1-3H3/b6-4- |
| InChIKey | APQMHTUCDYVMAS-XQRVVYSFSA-N |
| XLogP | 5.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.20 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|