C14H15BrClNO3S — CID 80530800
(5-bromo-4-chlorothiophen-2-yl)-(3,4,5-trimethoxyphenyl)methanamine (PubChem CID 80530800) has the molecular formula C14H15BrClNO3S and a molecular weight of 392.70 g/mol. Its IUPAC name is (5-bromo-4-chlorothiophen-2-yl)-(3,4,5-trimethoxyphenyl)methanamine.
| Compound Name | (5-bromo-4-chlorothiophen-2-yl)-(3,4,5-trimethoxyphenyl)methanamine |
|---|---|
| PubChem CID | 80530800 |
| Molecular Formula | C14H15BrClNO3S |
| Molecular Weight | 392.70 g/mol |
| Exact Mass | 390.96 |
| IUPAC Name | (5-bromo-4-chlorothiophen-2-yl)-(3,4,5-trimethoxyphenyl)methanamine |
| SMILES | COc1cc(C(N)c2cc(Cl)c(Br)s2)cc(OC)c1OC |
| InChI | InChI=1S/C14H15BrClNO3S/c1-18-9-4-7(5-10(19-2)13(9)20-3)12(17)11-6-8(16)14(15)21-11/h4-6,12H,17H2,1-3H3 |
| InChIKey | VKLWTQBJBXCPLT-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.70 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |