C12H10Br2ClNOS — CID 80532989
(4-chloro-2-methoxyphenyl)-(4,5-dibromothiophen-2-yl)methanamine (PubChem CID 80532989) has the molecular formula C12H10Br2ClNOS and a molecular weight of 411.55 g/mol. Its IUPAC name is (4-chloro-2-methoxyphenyl)-(4,5-dibromothiophen-2-yl)methanamine.
| Compound Name | (4-chloro-2-methoxyphenyl)-(4,5-dibromothiophen-2-yl)methanamine |
|---|---|
| PubChem CID | 80532989 |
| Molecular Formula | C12H10Br2ClNOS |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 408.85 |
| IUPAC Name | (4-chloro-2-methoxyphenyl)-(4,5-dibromothiophen-2-yl)methanamine |
| SMILES | COc1cc(Cl)ccc1C(N)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C12H10Br2ClNOS/c1-17-9-4-6(15)2-3-7(9)11(16)10-5-8(13)12(14)18-10/h2-5,11H,16H2,1H3 |
| InChIKey | JNSYVDIIIFWLOD-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |