C11H7Br2F2NS — CID 80536196
(4,5-dibromothiophen-2-yl)-(2,5-difluorophenyl)methanamine (PubChem CID 80536196) has the molecular formula C11H7Br2F2NS and a molecular weight of 383.06 g/mol. Its IUPAC name is (4,5-dibromothiophen-2-yl)-(2,5-difluorophenyl)methanamine.
| Compound Name | (4,5-dibromothiophen-2-yl)-(2,5-difluorophenyl)methanamine |
|---|---|
| PubChem CID | 80536196 |
| Molecular Formula | C11H7Br2F2NS |
| Molecular Weight | 383.06 g/mol |
| Exact Mass | 380.86 |
| IUPAC Name | (4,5-dibromothiophen-2-yl)-(2,5-difluorophenyl)methanamine |
| SMILES | NC(c1cc(Br)c(Br)s1)c1cc(F)ccc1F |
| InChI | InChI=1S/C11H7Br2F2NS/c12-7-4-9(17-11(7)13)10(16)6-3-5(14)1-2-8(6)15/h1-4,10H,16H2 |
| InChIKey | SRJAYHQPNBATHW-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.06 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |