C13H9F2NS2 — CID 80733937
(2,5-difluorophenyl)-thieno[3,2-b]thiophen-5-ylmethanamine (PubChem CID 80733937) has the molecular formula C13H9F2NS2 and a molecular weight of 281.35 g/mol. Its IUPAC name is (2,5-difluorophenyl)-thieno[3,2-b]thiophen-5-ylmethanamine.
| Compound Name | (2,5-difluorophenyl)-thieno[3,2-b]thiophen-5-ylmethanamine |
|---|---|
| PubChem CID | 80733937 |
| Molecular Formula | C13H9F2NS2 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.01 |
| IUPAC Name | (2,5-difluorophenyl)-thieno[3,2-b]thiophen-5-ylmethanamine |
| SMILES | NC(c1cc2sccc2s1)c1cc(F)ccc1F |
| InChI | InChI=1S/C13H9F2NS2/c14-7-1-2-9(15)8(5-7)13(16)12-6-11-10(18-12)3-4-17-11/h1-6,13H,16H2 |
| InChIKey | ONCICEKTVFHXPA-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |