C13H10BrNS2 — CID 80733537
(4-bromophenyl)-thieno[3,2-b]thiophen-5-ylmethanamine (PubChem CID 80733537) has the molecular formula C13H10BrNS2 and a molecular weight of 324.27 g/mol. Its IUPAC name is (4-bromophenyl)-thieno[3,2-b]thiophen-5-ylmethanamine.
| Compound Name | (4-bromophenyl)-thieno[3,2-b]thiophen-5-ylmethanamine |
|---|---|
| PubChem CID | 80733537 |
| Molecular Formula | C13H10BrNS2 |
| Molecular Weight | 324.27 g/mol |
| Exact Mass | 322.94 |
| IUPAC Name | (4-bromophenyl)-thieno[3,2-b]thiophen-5-ylmethanamine |
| SMILES | NC(c1ccc(Br)cc1)c1cc2sccc2s1 |
| InChI | InChI=1S/C13H10BrNS2/c14-9-3-1-8(2-4-9)13(15)12-7-11-10(17-12)5-6-16-11/h1-7,13H,15H2 |
| InChIKey | DQIBVVNVPYSHNI-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.27 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |