C13H16F5NO2 — CID 43626707
1-(4,5-dimethoxy-2-methylphenyl)-2,2,3,3,3-pentafluoro-N-methylpropan-1-amine (PubChem CID 43626707) has the molecular formula C13H16F5NO2 and a molecular weight of 313.27 g/mol. Its IUPAC name is 1-(4,5-dimethoxy-2-methylphenyl)-2,2,3,3,3-pentafluoro-N-methylpropan-1-amine.
| Compound Name | 1-(4,5-dimethoxy-2-methylphenyl)-2,2,3,3,3-pentafluoro-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 43626707 |
| Molecular Formula | C13H16F5NO2 |
| Molecular Weight | 313.27 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 1-(4,5-dimethoxy-2-methylphenyl)-2,2,3,3,3-pentafluoro-N-methylpropan-1-amine |
| SMILES | CNC(c1cc(OC)c(OC)cc1C)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H16F5NO2/c1-7-5-9(20-3)10(21-4)6-8(7)11(19-2)12(14,15)13(16,17)18/h5-6,11,19H,1-4H3 |
| InChIKey | PSNOGUOAZGWZEV-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.27 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|