C11H11BrF5NO — CID 60788133
1-(2-bromo-4-methoxyphenyl)-2,2,3,3,3-pentafluoro-N-methylpropan-1-amine (PubChem CID 60788133) has the molecular formula C11H11BrF5NO and a molecular weight of 348.11 g/mol. Its IUPAC name is 1-(2-bromo-4-methoxyphenyl)-2,2,3,3,3-pentafluoro-N-methylpropan-1-amine.
| Compound Name | 1-(2-bromo-4-methoxyphenyl)-2,2,3,3,3-pentafluoro-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 60788133 |
| Molecular Formula | C11H11BrF5NO |
| Molecular Weight | 348.11 g/mol |
| Exact Mass | 346.99 |
| IUPAC Name | 1-(2-bromo-4-methoxyphenyl)-2,2,3,3,3-pentafluoro-N-methylpropan-1-amine |
| SMILES | CNC(c1ccc(OC)cc1Br)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H11BrF5NO/c1-18-9(10(13,14)11(15,16)17)7-4-3-6(19-2)5-8(7)12/h3-5,9,18H,1-2H3 |
| InChIKey | SVVDCQDRPKZCDJ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.11 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|