C16H19BrO2S — CID 63543455
2-[2-bromo-2-(3,4-diethoxyphenyl)ethyl]thiophene (PubChem CID 63543455) has the molecular formula C16H19BrO2S and a molecular weight of 355.30 g/mol. Its IUPAC name is 2-[2-bromo-2-(3,4-diethoxyphenyl)ethyl]thiophene.
| Compound Name | 2-[2-bromo-2-(3,4-diethoxyphenyl)ethyl]thiophene |
|---|---|
| PubChem CID | 63543455 |
| Molecular Formula | C16H19BrO2S |
| Molecular Weight | 355.30 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | 2-[2-bromo-2-(3,4-diethoxyphenyl)ethyl]thiophene |
| SMILES | CCOc1ccc(C(Br)Cc2cccs2)cc1OCC |
| InChI | InChI=1S/C16H19BrO2S/c1-3-18-15-8-7-12(10-16(15)19-4-2)14(17)11-13-6-5-9-20-13/h5-10,14H,3-4,11H2,1-2H3 |
| InChIKey | ALMORDRFOWNEBM-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.30 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|