C16H25ClO2 — CID 55199459
4-(1-chloro-2-ethylbutyl)-1,2-diethoxybenzene (PubChem CID 55199459) has the molecular formula C16H25ClO2 and a molecular weight of 284.83 g/mol. Its IUPAC name is 4-(1-chloro-2-ethylbutyl)-1,2-diethoxybenzene.
| Compound Name | 4-(1-chloro-2-ethylbutyl)-1,2-diethoxybenzene |
|---|---|
| PubChem CID | 55199459 |
| Molecular Formula | C16H25ClO2 |
| Molecular Weight | 284.83 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 4-(1-chloro-2-ethylbutyl)-1,2-diethoxybenzene |
| SMILES | CCOc1ccc(C(Cl)C(CC)CC)cc1OCC |
| InChI | InChI=1S/C16H25ClO2/c1-5-12(6-2)16(17)13-9-10-14(18-7-3)15(11-13)19-8-4/h9-12,16H,5-8H2,1-4H3 |
| InChIKey | SUOJJSZHWNXTQN-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.83 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|