C9H12BrF2NO2 — CID 103149051
1-(3-bromofuran-2-yl)-3-(2,2-difluoroethoxy)propan-1-amine (PubChem CID 103149051) has the molecular formula C9H12BrF2NO2 and a molecular weight of 284.10 g/mol. Its IUPAC name is 1-(3-bromofuran-2-yl)-3-(2,2-difluoroethoxy)propan-1-amine.
| Compound Name | 1-(3-bromofuran-2-yl)-3-(2,2-difluoroethoxy)propan-1-amine |
|---|---|
| PubChem CID | 103149051 |
| Molecular Formula | C9H12BrF2NO2 |
| Molecular Weight | 284.10 g/mol |
| Exact Mass | 283.00 |
| IUPAC Name | 1-(3-bromofuran-2-yl)-3-(2,2-difluoroethoxy)propan-1-amine |
| SMILES | NC(CCOCC(F)F)c1occc1Br |
| InChI | InChI=1S/C9H12BrF2NO2/c10-6-1-4-15-9(6)7(13)2-3-14-5-8(11)12/h1,4,7-8H,2-3,5,13H2 |
| InChIKey | HXDPOQJUCKNUMQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.10 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|