C10H15BrN2O — CID 131091304
1-(3-bromofuran-2-yl)-2-pyrrolidin-1-ylethanamine (PubChem CID 131091304) has the molecular formula C10H15BrN2O and a molecular weight of 259.15 g/mol. Its IUPAC name is 1-(3-bromofuran-2-yl)-2-pyrrolidin-1-ylethanamine.
| Compound Name | 1-(3-bromofuran-2-yl)-2-pyrrolidin-1-ylethanamine |
|---|---|
| PubChem CID | 131091304 |
| Molecular Formula | C10H15BrN2O |
| Molecular Weight | 259.15 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 1-(3-bromofuran-2-yl)-2-pyrrolidin-1-ylethanamine |
| SMILES | NC(CN1CCCC1)c1occc1Br |
| InChI | InChI=1S/C10H15BrN2O/c11-8-3-6-14-10(8)9(12)7-13-4-1-2-5-13/h3,6,9H,1-2,4-5,7,12H2 |
| InChIKey | AHVNWGLGOQKIJL-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 42.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.15 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |