C13H22BrN3O — CID 105239993
[1-(3-bromofuran-2-yl)-2-methyl-2-piperidin-1-ylpropyl]hydrazine (PubChem CID 105239993) has the molecular formula C13H22BrN3O and a molecular weight of 316.24 g/mol. Its IUPAC name is [1-(3-bromofuran-2-yl)-2-methyl-2-piperidin-1-ylpropyl]hydrazine.
| Compound Name | [1-(3-bromofuran-2-yl)-2-methyl-2-piperidin-1-ylpropyl]hydrazine |
|---|---|
| PubChem CID | 105239993 |
| Molecular Formula | C13H22BrN3O |
| Molecular Weight | 316.24 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | [1-(3-bromofuran-2-yl)-2-methyl-2-piperidin-1-ylpropyl]hydrazine |
| SMILES | CC(C)(C(NN)c1occc1Br)N1CCCCC1 |
| InChI | InChI=1S/C13H22BrN3O/c1-13(2,17-7-4-3-5-8-17)12(16-15)11-10(14)6-9-18-11/h6,9,12,16H,3-5,7-8,15H2,1-2H3 |
| InChIKey | FNNYHCADUYWJRQ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 54.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.24 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|