C12H15ClF3NO — CID 103148864
1-(5-chloro-2-fluorophenyl)-4-(2,2-difluoroethoxy)butan-2-amine (PubChem CID 103148864) has the molecular formula C12H15ClF3NO and a molecular weight of 281.70 g/mol. Its IUPAC name is 1-(5-chloro-2-fluorophenyl)-4-(2,2-difluoroethoxy)butan-2-amine.
| Compound Name | 1-(5-chloro-2-fluorophenyl)-4-(2,2-difluoroethoxy)butan-2-amine |
|---|---|
| PubChem CID | 103148864 |
| Molecular Formula | C12H15ClF3NO |
| Molecular Weight | 281.70 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 1-(5-chloro-2-fluorophenyl)-4-(2,2-difluoroethoxy)butan-2-amine |
| SMILES | NC(CCOCC(F)F)Cc1cc(Cl)ccc1F |
| InChI | InChI=1S/C12H15ClF3NO/c13-9-1-2-11(14)8(5-9)6-10(17)3-4-18-7-12(15)16/h1-2,5,10,12H,3-4,6-7,17H2 |
| InChIKey | ISUOHMCHIWRXDB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.70 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|