C13H14ClF2NO3 — CID 103211053
6-[1-chloro-3-(2,2-difluoroethoxy)propyl]-3-methyl-1,3-benzoxazol-2-one (PubChem CID 103211053) has the molecular formula C13H14ClF2NO3 and a molecular weight of 305.71 g/mol. Its IUPAC name is 6-[1-chloro-3-(2,2-difluoroethoxy)propyl]-3-methyl-1,3-benzoxazol-2-one.
| Compound Name | 6-[1-chloro-3-(2,2-difluoroethoxy)propyl]-3-methyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 103211053 |
| Molecular Formula | C13H14ClF2NO3 |
| Molecular Weight | 305.71 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 6-[1-chloro-3-(2,2-difluoroethoxy)propyl]-3-methyl-1,3-benzoxazol-2-one |
| SMILES | Cn1c(=O)oc2cc(C(Cl)CCOCC(F)F)ccc21 |
| InChI | InChI=1S/C13H14ClF2NO3/c1-17-10-3-2-8(6-11(10)20-13(17)18)9(14)4-5-19-7-12(15)16/h2-3,6,9,12H,4-5,7H2,1H3 |
| InChIKey | ZSRQUEXYHJJCKV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 44.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.71 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|