C13H16Cl2F2O — CID 103211133
1-chloro-4-[1-chloro-3-(2,2-difluoroethoxy)propyl]-2,5-dimethylbenzene (PubChem CID 103211133) has the molecular formula C13H16Cl2F2O and a molecular weight of 297.17 g/mol. Its IUPAC name is 1-chloro-4-[1-chloro-3-(2,2-difluoroethoxy)propyl]-2,5-dimethylbenzene.
| Compound Name | 1-chloro-4-[1-chloro-3-(2,2-difluoroethoxy)propyl]-2,5-dimethylbenzene |
|---|---|
| PubChem CID | 103211133 |
| Molecular Formula | C13H16Cl2F2O |
| Molecular Weight | 297.17 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 1-chloro-4-[1-chloro-3-(2,2-difluoroethoxy)propyl]-2,5-dimethylbenzene |
| SMILES | Cc1cc(C(Cl)CCOCC(F)F)c(C)cc1Cl |
| InChI | InChI=1S/C13H16Cl2F2O/c1-8-6-12(15)9(2)5-10(8)11(14)3-4-18-7-13(16)17/h5-6,11,13H,3-4,7H2,1-2H3 |
| InChIKey | JAWFAWNEUCJKOX-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.17 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|