C15H22ClF2NO — CID 103207627
1-(4-chloro-2,5-dimethylphenyl)-3-(2,2-difluoroethoxy)-N-ethylpropan-1-amine (PubChem CID 103207627) has the molecular formula C15H22ClF2NO and a molecular weight of 305.80 g/mol. Its IUPAC name is 1-(4-chloro-2,5-dimethylphenyl)-3-(2,2-difluoroethoxy)-N-ethylpropan-1-amine.
| Compound Name | 1-(4-chloro-2,5-dimethylphenyl)-3-(2,2-difluoroethoxy)-N-ethylpropan-1-amine |
|---|---|
| PubChem CID | 103207627 |
| Molecular Formula | C15H22ClF2NO |
| Molecular Weight | 305.80 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 1-(4-chloro-2,5-dimethylphenyl)-3-(2,2-difluoroethoxy)-N-ethylpropan-1-amine |
| SMILES | CCNC(CCOCC(F)F)c1cc(C)c(Cl)cc1C |
| InChI | InChI=1S/C15H22ClF2NO/c1-4-19-14(5-6-20-9-15(17)18)12-7-11(3)13(16)8-10(12)2/h7-8,14-15,19H,4-6,9H2,1-3H3 |
| InChIKey | YYWGWTHDJHYPRL-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.80 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|