C11H16ClF2NOS — CID 103149716
1-(5-chlorothiophen-2-yl)-3-(2,2-difluoroethoxy)-N-ethylpropan-1-amine (PubChem CID 103149716) has the molecular formula C11H16ClF2NOS and a molecular weight of 283.77 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)-3-(2,2-difluoroethoxy)-N-ethylpropan-1-amine.
| Compound Name | 1-(5-chlorothiophen-2-yl)-3-(2,2-difluoroethoxy)-N-ethylpropan-1-amine |
|---|---|
| PubChem CID | 103149716 |
| Molecular Formula | C11H16ClF2NOS |
| Molecular Weight | 283.77 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)-3-(2,2-difluoroethoxy)-N-ethylpropan-1-amine |
| SMILES | CCNC(CCOCC(F)F)c1ccc(Cl)s1 |
| InChI | InChI=1S/C11H16ClF2NOS/c1-2-15-8(5-6-16-7-11(13)14)9-3-4-10(12)17-9/h3-4,8,11,15H,2,5-7H2,1H3 |
| InChIKey | AGGORLZIWPVVLU-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.77 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|