C16H23ClF2O — CID 103211192
1-[1-chloro-3-(2,2-difluoroethoxy)propyl]-4-(2-methylbutan-2-yl)benzene (PubChem CID 103211192) has the molecular formula C16H23ClF2O and a molecular weight of 304.81 g/mol. Its IUPAC name is 1-[1-chloro-3-(2,2-difluoroethoxy)propyl]-4-(2-methylbutan-2-yl)benzene.
| Compound Name | 1-[1-chloro-3-(2,2-difluoroethoxy)propyl]-4-(2-methylbutan-2-yl)benzene |
|---|---|
| PubChem CID | 103211192 |
| Molecular Formula | C16H23ClF2O |
| Molecular Weight | 304.81 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 1-[1-chloro-3-(2,2-difluoroethoxy)propyl]-4-(2-methylbutan-2-yl)benzene |
| SMILES | CCC(C)(C)c1ccc(C(Cl)CCOCC(F)F)cc1 |
| InChI | InChI=1S/C16H23ClF2O/c1-4-16(2,3)13-7-5-12(6-8-13)14(17)9-10-20-11-15(18)19/h5-8,14-15H,4,9-11H2,1-3H3 |
| InChIKey | SRTPNUIXDFQGBU-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.81 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|