About N-[2-chloro-2-(3,4-dichlorophenyl)ethyl]-2-methylbutan-2-amine
N-[2-chloro-2-(3,4-dichlorophenyl)ethyl]-2-methylbutan-2-amine (PubChem CID 19063936) has the molecular formula C13H18Cl3N
and a molecular weight of 294.65 g/mol. Its IUPAC name is N-[2-chloro-2-(3,4-dichlorophenyl)ethyl]-2-methylbutan-2-amine.
Molecular Properties
| Compound Name | N-[2-chloro-2-(3,4-dichlorophenyl)ethyl]-2-methylbutan-2-amine |
| PubChem CID | 19063936 |
| Molecular Formula | C13H18Cl3N |
| Molecular Weight | 294.65 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | N-[2-chloro-2-(3,4-dichlorophenyl)ethyl]-2-methylbutan-2-amine |
| SMILES | CCC(C)(C)NCC(Cl)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H18Cl3N/c1-4-13(2,3)17-8-12(16)9-5-6-10(14)11(15)7-9/h5-7,12,17H,4,8H2,1-3H3 |
| InChIKey | XHCBYJCCEBSBPW-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.65 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-[2-chloro-2-(3,4-dichlorophenyl)ethyl]-2-methylbutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-chloro-2-(3,4-dichlorophenyl)ethyl]-2-methylbutan-2-amine?
The IUPAC name of N-[2-chloro-2-(3,4-dichlorophenyl)ethyl]-2-methylbutan-2-amine (CID 19063936) is N-[2-chloro-2-(3,4-dichlorophenyl)ethyl]-2-methylbutan-2-amine.
What is the SMILES notation for N-[2-chloro-2-(3,4-dichlorophenyl)ethyl]-2-methylbutan-2-amine?
The canonical SMILES for N-[2-chloro-2-(3,4-dichlorophenyl)ethyl]-2-methylbutan-2-amine is CCC(C)(C)NCC(Cl)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of N-[2-chloro-2-(3,4-dichlorophenyl)ethyl]-2-methylbutan-2-amine?
The InChIKey is XHCBYJCCEBSBPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18Cl3N/c1-4-13(2,3)17-8-12(16)9-5-6-10(14)11(15)7-9/h5-7,12,17H,4,8H2,1-3H3.
What are the key properties of N-[2-chloro-2-(3,4-dichlorophenyl)ethyl]-2-methylbutan-2-amine?
N-[2-chloro-2-(3,4-dichlorophenyl)ethyl]-2-methylbutan-2-amine has a molecular weight of 294.65 g/mol, XLogP of 5.05, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-chloro-2-(3,4-dichlorophenyl)ethyl]-2-methylbutan-2-amine is sourced from PubChem (CID 19063936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).