C12H15Cl2F2NO — CID 113463351
3-[1-(3,4-dichlorophenyl)propylamino]-2,2-difluoropropan-1-ol (PubChem CID 113463351) has the molecular formula C12H15Cl2F2NO and a molecular weight of 298.16 g/mol. Its IUPAC name is 3-[1-(3,4-dichlorophenyl)propylamino]-2,2-difluoropropan-1-ol.
| Compound Name | 3-[1-(3,4-dichlorophenyl)propylamino]-2,2-difluoropropan-1-ol |
|---|---|
| PubChem CID | 113463351 |
| Molecular Formula | C12H15Cl2F2NO |
| Molecular Weight | 298.16 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 3-[1-(3,4-dichlorophenyl)propylamino]-2,2-difluoropropan-1-ol |
| SMILES | CCC(NCC(F)(F)CO)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H15Cl2F2NO/c1-2-11(17-6-12(15,16)7-18)8-3-4-9(13)10(14)5-8/h3-5,11,17-18H,2,6-7H2,1H3 |
| InChIKey | JYYLHZCBGGLRJX-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.16 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |