C12H13Cl2F4N — CID 106289930
N-[1-(3,4-dichlorophenyl)propyl]-2,2,3,3-tetrafluoropropan-1-amine (PubChem CID 106289930) has the molecular formula C12H13Cl2F4N and a molecular weight of 318.14 g/mol. Its IUPAC name is N-[1-(3,4-dichlorophenyl)propyl]-2,2,3,3-tetrafluoropropan-1-amine.
| Compound Name | N-[1-(3,4-dichlorophenyl)propyl]-2,2,3,3-tetrafluoropropan-1-amine |
|---|---|
| PubChem CID | 106289930 |
| Molecular Formula | C12H13Cl2F4N |
| Molecular Weight | 318.14 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | N-[1-(3,4-dichlorophenyl)propyl]-2,2,3,3-tetrafluoropropan-1-amine |
| SMILES | CCC(NCC(F)(F)C(F)F)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H13Cl2F4N/c1-2-10(19-6-12(17,18)11(15)16)7-3-4-8(13)9(14)5-7/h3-5,10-11,19H,2,6H2,1H3 |
| InChIKey | WGDCSVFNELIEOP-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.14 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|