C13H16Cl2N2 — CID 62647103
3-[1-(3,4-dichlorophenyl)propylamino]-2-methylpropanenitrile (PubChem CID 62647103) has the molecular formula C13H16Cl2N2 and a molecular weight of 271.19 g/mol. Its IUPAC name is 3-[1-(3,4-dichlorophenyl)propylamino]-2-methylpropanenitrile.
| Compound Name | 3-[1-(3,4-dichlorophenyl)propylamino]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 62647103 |
| Molecular Formula | C13H16Cl2N2 |
| Molecular Weight | 271.19 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 3-[1-(3,4-dichlorophenyl)propylamino]-2-methylpropanenitrile |
| SMILES | CCC(NCC(C)C#N)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H16Cl2N2/c1-3-13(17-8-9(2)7-16)10-4-5-11(14)12(15)6-10/h4-6,9,13,17H,3,8H2,1-2H3 |
| InChIKey | DDJJAXWQLXXILB-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.19 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |