C15H17Cl2NOS — CID 103785268
2-[1-(3,4-dichlorophenyl)propylamino]-1-thiophen-3-ylethanol (PubChem CID 103785268) has the molecular formula C15H17Cl2NOS and a molecular weight of 330.28 g/mol. Its IUPAC name is 2-[1-(3,4-dichlorophenyl)propylamino]-1-thiophen-3-ylethanol.
| Compound Name | 2-[1-(3,4-dichlorophenyl)propylamino]-1-thiophen-3-ylethanol |
|---|---|
| PubChem CID | 103785268 |
| Molecular Formula | C15H17Cl2NOS |
| Molecular Weight | 330.28 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | 2-[1-(3,4-dichlorophenyl)propylamino]-1-thiophen-3-ylethanol |
| SMILES | CCC(NCC(O)c1ccsc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H17Cl2NOS/c1-2-14(10-3-4-12(16)13(17)7-10)18-8-15(19)11-5-6-20-9-11/h3-7,9,14-15,18-19H,2,8H2,1H3 |
| InChIKey | VXFGQCSIANKAJJ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.28 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |