C16H14Cl2N2 — CID 43763746
4-[1-(3,4-dichlorophenyl)propylamino]benzonitrile (PubChem CID 43763746) has the molecular formula C16H14Cl2N2 and a molecular weight of 305.21 g/mol. Its IUPAC name is 4-[1-(3,4-dichlorophenyl)propylamino]benzonitrile.
| Compound Name | 4-[1-(3,4-dichlorophenyl)propylamino]benzonitrile |
|---|---|
| PubChem CID | 43763746 |
| Molecular Formula | C16H14Cl2N2 |
| Molecular Weight | 305.21 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 4-[1-(3,4-dichlorophenyl)propylamino]benzonitrile |
| SMILES | CCC(Nc1ccc(C#N)cc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H14Cl2N2/c1-2-16(12-5-8-14(17)15(18)9-12)20-13-6-3-11(10-19)4-7-13/h3-9,16,20H,2H2,1H3 |
| InChIKey | PWKUDMOMQTTZHZ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.21 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |