C12H12Cl2N2S — CID 79046612
N-[1-(3,4-dichlorophenyl)propyl]-1,3-thiazol-2-amine (PubChem CID 79046612) has the molecular formula C12H12Cl2N2S and a molecular weight of 287.22 g/mol. Its IUPAC name is N-[1-(3,4-dichlorophenyl)propyl]-1,3-thiazol-2-amine.
| Compound Name | N-[1-(3,4-dichlorophenyl)propyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 79046612 |
| Molecular Formula | C12H12Cl2N2S |
| Molecular Weight | 287.22 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | N-[1-(3,4-dichlorophenyl)propyl]-1,3-thiazol-2-amine |
| SMILES | CCC(Nc1nccs1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H12Cl2N2S/c1-2-11(16-12-15-5-6-17-12)8-3-4-9(13)10(14)7-8/h3-7,11H,2H2,1H3,(H,15,16) |
| InChIKey | OEPKRZKOHVPHIB-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.22 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |