C16H16Cl3NO — CID 43758094
3-chloro-N-[1-(3,4-dichlorophenyl)propyl]-4-methoxyaniline (PubChem CID 43758094) has the molecular formula C16H16Cl3NO and a molecular weight of 344.67 g/mol. Its IUPAC name is 3-chloro-N-[1-(3,4-dichlorophenyl)propyl]-4-methoxyaniline.
| Compound Name | 3-chloro-N-[1-(3,4-dichlorophenyl)propyl]-4-methoxyaniline |
|---|---|
| PubChem CID | 43758094 |
| Molecular Formula | C16H16Cl3NO |
| Molecular Weight | 344.67 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | 3-chloro-N-[1-(3,4-dichlorophenyl)propyl]-4-methoxyaniline |
| SMILES | CCC(Nc1ccc(OC)c(Cl)c1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H16Cl3NO/c1-3-15(10-4-6-12(17)13(18)8-10)20-11-5-7-16(21-2)14(19)9-11/h4-9,15,20H,3H2,1-2H3 |
| InChIKey | OVRSAOZOEDHOFW-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.67 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|