C14H8Cl6S — CID 159143973
1,2-dichloro-4-[chloro-[chloro-(3,4-dichlorophenyl)methyl]sulfanylmethyl]benzene (PubChem CID 159143973) has the molecular formula C14H8Cl6S and a molecular weight of 421.00 g/mol. Its IUPAC name is 1,2-dichloro-4-[chloro-[chloro-(3,4-dichlorophenyl)methyl]sulfanylmethyl]benzene.
| Compound Name | 1,2-dichloro-4-[chloro-[chloro-(3,4-dichlorophenyl)methyl]sulfanylmethyl]benzene |
|---|---|
| PubChem CID | 159143973 |
| Molecular Formula | C14H8Cl6S |
| Molecular Weight | 421.00 g/mol |
| Exact Mass | 417.85 |
| IUPAC Name | 1,2-dichloro-4-[chloro-[chloro-(3,4-dichlorophenyl)methyl]sulfanylmethyl]benzene |
| SMILES | Clc1ccc(C(Cl)SC(Cl)c2ccc(Cl)c(Cl)c2)cc1Cl |
| InChI | InChI=1S/C14H8Cl6S/c15-9-3-1-7(5-11(9)17)13(19)21-14(20)8-2-4-10(16)12(18)6-8/h1-6,13-14H |
| InChIKey | KILGRDQUAUJEOX-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.00 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|