C8H4BrCl2O2- — CID 18951153
2-bromo-2-(3,4-dichlorophenyl)acetate (PubChem CID 18951153) has the molecular formula C8H4BrCl2O2- and a molecular weight of 282.93 g/mol. Its IUPAC name is 2-bromo-2-(3,4-dichlorophenyl)acetate.
| Compound Name | 2-bromo-2-(3,4-dichlorophenyl)acetate |
|---|---|
| PubChem CID | 18951153 |
| Molecular Formula | C8H4BrCl2O2- |
| Molecular Weight | 282.93 g/mol |
| Exact Mass | 280.88 |
| IUPAC Name | 2-bromo-2-(3,4-dichlorophenyl)acetate |
| SMILES | O=C([O-])C(Br)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C8H5BrCl2O2/c9-7(8(12)13)4-1-2-5(10)6(11)3-4/h1-3,7H,(H,12,13)/p-1 |
| InChIKey | IACGHLYHQNBYMP-UHFFFAOYSA-M |
| XLogP | 2.18 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.93 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|