C9H4Cl8 — CID 19844389
1,2-dichloro-4-(1,1,1,3,3,3-hexachloropropan-2-yl)benzene (PubChem CID 19844389) has the molecular formula C9H4Cl8 and a molecular weight of 395.76 g/mol. Its IUPAC name is 1,2-dichloro-4-(1,1,1,3,3,3-hexachloropropan-2-yl)benzene.
| Compound Name | 1,2-dichloro-4-(1,1,1,3,3,3-hexachloropropan-2-yl)benzene |
|---|---|
| PubChem CID | 19844389 |
| Molecular Formula | C9H4Cl8 |
| Molecular Weight | 395.76 g/mol |
| Exact Mass | 391.78 |
| IUPAC Name | 1,2-dichloro-4-(1,1,1,3,3,3-hexachloropropan-2-yl)benzene |
| SMILES | Clc1ccc(C(C(Cl)(Cl)Cl)C(Cl)(Cl)Cl)cc1Cl |
| InChI | InChI=1S/C9H4Cl8/c10-5-2-1-4(3-6(5)11)7(8(12,13)14)9(15,16)17/h1-3,7H |
| InChIKey | YTVUPNSSONRYMS-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.76 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|