C11H15NO2 — CID 83698233
O-[3-(2,3-dihydro-1-benzofuran-5-yl)propyl]hydroxylamine (PubChem CID 83698233) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is O-[3-(2,3-dihydro-1-benzofuran-5-yl)propyl]hydroxylamine.
| Compound Name | O-[3-(2,3-dihydro-1-benzofuran-5-yl)propyl]hydroxylamine |
|---|---|
| PubChem CID | 83698233 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | O-[3-(2,3-dihydro-1-benzofuran-5-yl)propyl]hydroxylamine |
| SMILES | NOCCCc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C11H15NO2/c12-14-6-1-2-9-3-4-11-10(8-9)5-7-13-11/h3-4,8H,1-2,5-7,12H2 |
| InChIKey | AVINIXVJAJTHHU-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|