C20H20N6O2 — CID 55809331
1-[3-(2-oxoimidazolidin-1-yl)phenyl]-3-[[4-(1H-pyrazol-5-yl)phenyl]methyl]urea (PubChem CID 55809331) has the molecular formula C20H20N6O2 and a molecular weight of 376.42 g/mol. Its IUPAC name is 1-[3-(2-oxoimidazolidin-1-yl)phenyl]-3-[[4-(1H-pyrazol-5-yl)phenyl]methyl]urea.
| Compound Name | 1-[3-(2-oxoimidazolidin-1-yl)phenyl]-3-[[4-(1H-pyrazol-5-yl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 55809331 |
| Molecular Formula | C20H20N6O2 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 1-[3-(2-oxoimidazolidin-1-yl)phenyl]-3-[[4-(1H-pyrazol-5-yl)phenyl]methyl]urea |
| SMILES | O=C(NCc1ccc(-c2ccn[nH]2)cc1)Nc1cccc(N2CCNC2=O)c1 |
| InChI | InChI=1S/C20H20N6O2/c27-19(22-13-14-4-6-15(7-5-14)18-8-9-23-25-18)24-16-2-1-3-17(12-16)26-11-10-21-20(26)28/h1-9,12H,10-11,13H2,(H,21,28)(H,23,25)(H2,22,24,27) |
| InChIKey | SINDUGSCQLOBTF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |