C18H18N4O3S — CID 55840948
2-methyl-N-[[4-(1H-pyrazol-5-yl)phenyl]methyl]-5-sulfamoylbenzamide (PubChem CID 55840948) has the molecular formula C18H18N4O3S and a molecular weight of 370.43 g/mol. Its IUPAC name is 2-methyl-N-[[4-(1H-pyrazol-5-yl)phenyl]methyl]-5-sulfamoylbenzamide.
| Compound Name | 2-methyl-N-[[4-(1H-pyrazol-5-yl)phenyl]methyl]-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 55840948 |
| Molecular Formula | C18H18N4O3S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 2-methyl-N-[[4-(1H-pyrazol-5-yl)phenyl]methyl]-5-sulfamoylbenzamide |
| SMILES | Cc1ccc(S(N)(=O)=O)cc1C(=O)NCc1ccc(-c2ccn[nH]2)cc1 |
| InChI | InChI=1S/C18H18N4O3S/c1-12-2-7-15(26(19,24)25)10-16(12)18(23)20-11-13-3-5-14(6-4-13)17-8-9-21-22-17/h2-10H,11H2,1H3,(H,20,23)(H,21,22)(H2,19,24,25) |
| InChIKey | ZFWCIAJDEOCCBS-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |