C13H9N3O5S2 — CID 46506200
N-(3-nitrophenyl)-2-oxo-3H-1,3-benzothiazole-6-sulfonamide (PubChem CID 46506200) has the molecular formula C13H9N3O5S2 and a molecular weight of 351.37 g/mol. Its IUPAC name is N-(3-nitrophenyl)-2-oxo-3H-1,3-benzothiazole-6-sulfonamide.
| Compound Name | N-(3-nitrophenyl)-2-oxo-3H-1,3-benzothiazole-6-sulfonamide |
|---|---|
| PubChem CID | 46506200 |
| Molecular Formula | C13H9N3O5S2 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.00 |
| IUPAC Name | N-(3-nitrophenyl)-2-oxo-3H-1,3-benzothiazole-6-sulfonamide |
| SMILES | O=c1[nH]c2ccc(S(=O)(=O)Nc3cccc([N+](=O)[O-])c3)cc2s1 |
| InChI | InChI=1S/C13H9N3O5S2/c17-13-14-11-5-4-10(7-12(11)22-13)23(20,21)15-8-2-1-3-9(6-8)16(18)19/h1-7,15H,(H,14,17) |
| InChIKey | FWVIVYOSFMDPFP-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 122.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|