C16H12N2O5S2 — CID 166397291
(E)-3-[3-[(2-oxo-3H-1,3-benzothiazol-6-yl)sulfonylamino]phenyl]prop-2-enoic acid (PubChem CID 166397291) has the molecular formula C16H12N2O5S2 and a molecular weight of 376.42 g/mol. Its IUPAC name is (E)-3-[3-[(2-oxo-3H-1,3-benzothiazol-6-yl)sulfonylamino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[(2-oxo-3H-1,3-benzothiazol-6-yl)sulfonylamino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 166397291 |
| Molecular Formula | C16H12N2O5S2 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | (E)-3-[3-[(2-oxo-3H-1,3-benzothiazol-6-yl)sulfonylamino]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cccc(NS(=O)(=O)c2ccc3[nH]c(=O)sc3c2)c1 |
| InChI | InChI=1S/C16H12N2O5S2/c19-15(20)7-4-10-2-1-3-11(8-10)18-25(22,23)12-5-6-13-14(9-12)24-16(21)17-13/h1-9,18H,(H,17,21)(H,19,20)/b7-4+ |
| InChIKey | LDTXKIKEQXNRSE-QPJJXVBHSA-N |
| XLogP | 2.49 |
| TPSA | 116.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|