C16H13NO6S — CID 673258
3-[[4-[(E)-2-carboxyethenyl]phenyl]sulfonylamino]benzoic acid (PubChem CID 673258) has the molecular formula C16H13NO6S and a molecular weight of 347.35 g/mol. Its IUPAC name is 3-[[4-[(E)-2-carboxyethenyl]phenyl]sulfonylamino]benzoic acid.
| Compound Name | 3-[[4-[(E)-2-carboxyethenyl]phenyl]sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 673258 |
| Molecular Formula | C16H13NO6S |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | 3-[[4-[(E)-2-carboxyethenyl]phenyl]sulfonylamino]benzoic acid |
| SMILES | O=C(O)/C=C/c1ccc(S(=O)(=O)Nc2cccc(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C16H13NO6S/c18-15(19)9-6-11-4-7-14(8-5-11)24(22,23)17-13-3-1-2-12(10-13)16(20)21/h1-10,17H,(H,18,19)(H,20,21)/b9-6+ |
| InChIKey | NLQPLVHOMRWENT-RMKNXTFCSA-N |
| XLogP | 2.28 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|